C14H17F3N2OS — CID 58563112
(5R)-5-(5-amino-2-fluorophenyl)-6,6-difluoro-5,7,7-trimethyl-1,4-oxazepane-3-thione (PubChem CID 58563112) has the molecular formula C14H17F3N2OS and a molecular weight of 318.36 g/mol. Its IUPAC name is (5R)-5-(5-amino-2-fluorophenyl)-6,6-difluoro-5,7,7-trimethyl-1,4-oxazepane-3-thione.
| Compound Name | (5R)-5-(5-amino-2-fluorophenyl)-6,6-difluoro-5,7,7-trimethyl-1,4-oxazepane-3-thione |
|---|---|
| PubChem CID | 58563112 |
| Molecular Formula | C14H17F3N2OS |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | (5R)-5-(5-amino-2-fluorophenyl)-6,6-difluoro-5,7,7-trimethyl-1,4-oxazepane-3-thione |
| SMILES | CC1(C)OCC(=S)N[C@](C)(c2cc(N)ccc2F)C1(F)F |
| InChI | InChI=1S/C14H17F3N2OS/c1-12(2)14(16,17)13(3,19-11(21)7-20-12)9-6-8(18)4-5-10(9)15/h4-6H,7,18H2,1-3H3,(H,19,21)/t13-/m1/s1 |
| InChIKey | KDXXBRVOFWODCA-CYBMUJFWSA-N |
| XLogP | 2.98 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|