C14H14BrF4NO2 — CID 58563115
(5R)-5-(5-bromo-2,4-difluorophenyl)-6,6-difluoro-5,7,7-trimethyl-1,4-oxazepan-3-one (PubChem CID 58563115) has the molecular formula C14H14BrF4NO2 and a molecular weight of 384.17 g/mol. Its IUPAC name is (5R)-5-(5-bromo-2,4-difluorophenyl)-6,6-difluoro-5,7,7-trimethyl-1,4-oxazepan-3-one.
| Compound Name | (5R)-5-(5-bromo-2,4-difluorophenyl)-6,6-difluoro-5,7,7-trimethyl-1,4-oxazepan-3-one |
|---|---|
| PubChem CID | 58563115 |
| Molecular Formula | C14H14BrF4NO2 |
| Molecular Weight | 384.17 g/mol |
| Exact Mass | 383.01 |
| IUPAC Name | (5R)-5-(5-bromo-2,4-difluorophenyl)-6,6-difluoro-5,7,7-trimethyl-1,4-oxazepan-3-one |
| SMILES | CC1(C)OCC(=O)N[C@](C)(c2cc(Br)c(F)cc2F)C1(F)F |
| InChI | InChI=1S/C14H14BrF4NO2/c1-12(2)14(18,19)13(3,20-11(21)6-22-12)7-4-8(15)10(17)5-9(7)16/h4-5H,6H2,1-3H3,(H,20,21)/t13-/m1/s1 |
| InChIKey | LPMSDBLFYSNXTE-CYBMUJFWSA-N |
| XLogP | 3.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.17 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|