C13H19NO2 — CID 58564131
ethyl 2-(2-methyl-4,5,6,7-tetrahydroindol-1-yl)acetate (PubChem CID 58564131) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is ethyl 2-(2-methyl-4,5,6,7-tetrahydroindol-1-yl)acetate.
| Compound Name | ethyl 2-(2-methyl-4,5,6,7-tetrahydroindol-1-yl)acetate |
|---|---|
| PubChem CID | 58564131 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | ethyl 2-(2-methyl-4,5,6,7-tetrahydroindol-1-yl)acetate |
| SMILES | CCOC(=O)Cn1c(C)cc2c1CCCC2 |
| InChI | InChI=1S/C13H19NO2/c1-3-16-13(15)9-14-10(2)8-11-6-4-5-7-12(11)14/h8H,3-7,9H2,1-2H3 |
| InChIKey | JGMXEWKETVLCCJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |