4-(1,3-benzoxazol-2-ylsulfanylmethyl)benzoic acid

C15H11NO3S — CID 585642

IUPAC4-(1,3-benzoxazol-2-ylsulfanylmethyl)benzoic acid
SMILESO=C(O)c1ccc(CSc2nc3ccccc3o2)cc1
InChIInChI=1S/C15H11NO3S/c17-14(18)11-7-5-10(6-8-11)9-20-15-16-12-3-1-2-4-13(12)19-15/h1-8H,9H2,(H,17,18)
InChIKeyXCKAGLDDLJTRBV-UHFFFAOYSA-N
MW285.32 g/mol
LogP3.82
Rot. Bonds4

About 4-(1,3-benzoxazol-2-ylsulfanylmethyl)benzoic acid

4-(1,3-benzoxazol-2-ylsulfanylmethyl)benzoic acid (PubChem CID 585642) has the molecular formula C15H11NO3S and a molecular weight of 285.32 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-2-ylsulfanylmethyl)benzoic acid.

Molecular Properties

Compound Name4-(1,3-benzoxazol-2-ylsulfanylmethyl)benzoic acid
PubChem CID585642
Molecular FormulaC15H11NO3S
Molecular Weight285.32 g/mol
Exact Mass285.05
IUPAC Name4-(1,3-benzoxazol-2-ylsulfanylmethyl)benzoic acid
SMILESO=C(O)c1ccc(CSc2nc3ccccc3o2)cc1
InChIInChI=1S/C15H11NO3S/c17-14(18)11-7-5-10(6-8-11)9-20-15-16-12-3-1-2-4-13(12)19-15/h1-8H,9H2,(H,17,18)
InChIKeyXCKAGLDDLJTRBV-UHFFFAOYSA-N
XLogP3.82
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.32
LogP ≤ 53.82
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-(1,3-benzoxazol-2-ylsulfanylmethyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1,3-benzoxazol-2-ylsulfanylmethyl)benzoic acid?
The IUPAC name of 4-(1,3-benzoxazol-2-ylsulfanylmethyl)benzoic acid (CID 585642) is 4-(1,3-benzoxazol-2-ylsulfanylmethyl)benzoic acid.
What is the SMILES notation for 4-(1,3-benzoxazol-2-ylsulfanylmethyl)benzoic acid?
The canonical SMILES for 4-(1,3-benzoxazol-2-ylsulfanylmethyl)benzoic acid is O=C(O)c1ccc(CSc2nc3ccccc3o2)cc1.
What is the InChIKey of 4-(1,3-benzoxazol-2-ylsulfanylmethyl)benzoic acid?
The InChIKey is XCKAGLDDLJTRBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO3S/c17-14(18)11-7-5-10(6-8-11)9-20-15-16-12-3-1-2-4-13(12)19-15/h1-8H,9H2,(H,17,18).
What are the key properties of 4-(1,3-benzoxazol-2-ylsulfanylmethyl)benzoic acid?
4-(1,3-benzoxazol-2-ylsulfanylmethyl)benzoic acid has a molecular weight of 285.32 g/mol, XLogP of 3.82, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzoxazol-2-ylsulfanylmethyl)benzoic acid is sourced from PubChem (CID 585642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).