C16H12Br2N2O — CID 58564622
2-[2-(bromomethyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-1-(2-bromophenyl)ethanone (PubChem CID 58564622) has the molecular formula C16H12Br2N2O and a molecular weight of 408.09 g/mol. Its IUPAC name is 2-[2-(bromomethyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-1-(2-bromophenyl)ethanone.
| Compound Name | 2-[2-(bromomethyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-1-(2-bromophenyl)ethanone |
|---|---|
| PubChem CID | 58564622 |
| Molecular Formula | C16H12Br2N2O |
| Molecular Weight | 408.09 g/mol |
| Exact Mass | 405.93 |
| IUPAC Name | 2-[2-(bromomethyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-1-(2-bromophenyl)ethanone |
| SMILES | O=C(Cc1cnc2[nH]c(CBr)cc2c1)c1ccccc1Br |
| InChI | InChI=1S/C16H12Br2N2O/c17-8-12-7-11-5-10(9-19-16(11)20-12)6-15(21)13-3-1-2-4-14(13)18/h1-5,7,9H,6,8H2,(H,19,20) |
| InChIKey | NECJIGJJWSPWBZ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.09 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|