C16H20N4O2S2 — CID 58564886
5,13-ditert-butyl-2,9-dithia-5,6,12,13-tetrazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),6,11-tetraene-4,14-dione (PubChem CID 58564886) has the molecular formula C16H20N4O2S2 and a molecular weight of 364.50 g/mol. Its IUPAC name is 5,13-ditert-butyl-2,9-dithia-5,6,12,13-tetrazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),6,11-tetraene-4,14-dione.
| Compound Name | 5,13-ditert-butyl-2,9-dithia-5,6,12,13-tetrazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),6,11-tetraene-4,14-dione |
|---|---|
| PubChem CID | 58564886 |
| Molecular Formula | C16H20N4O2S2 |
| Molecular Weight | 364.50 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 5,13-ditert-butyl-2,9-dithia-5,6,12,13-tetrazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),6,11-tetraene-4,14-dione |
| SMILES | CC(C)(C)n1ncc2c(c1=O)Sc1c(cnn(C(C)(C)C)c1=O)S2 |
| InChI | InChI=1S/C16H20N4O2S2/c1-15(2,3)19-13(21)11-9(7-17-19)23-10-8-18-20(16(4,5)6)14(22)12(10)24-11/h7-8H,1-6H3 |
| InChIKey | HSCLLPZITXWWEC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.50 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |