C24H21F3N2O4S — CID 58565941
4-methylidene-5-[(4R)-7-[[1-oxo-2-(2,2,2-trifluoroethyl)-3,4-dihydroisoquinolin-4-yl]oxy]-3,4-dihydro-2H-chromen-4-yl]-1,3-thiazolidin-2-one (PubChem CID 58565941) has the molecular formula C24H21F3N2O4S and a molecular weight of 490.50 g/mol. Its IUPAC name is 4-methylidene-5-[(4R)-7-[[1-oxo-2-(2,2,2-trifluoroethyl)-3,4-dihydroisoquinolin-4-yl]oxy]-3,4-dihydro-2H-chromen-4-yl]-1,3-thiazolidin-2-one.
| Compound Name | 4-methylidene-5-[(4R)-7-[[1-oxo-2-(2,2,2-trifluoroethyl)-3,4-dihydroisoquinolin-4-yl]oxy]-3,4-dihydro-2H-chromen-4-yl]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 58565941 |
| Molecular Formula | C24H21F3N2O4S |
| Molecular Weight | 490.50 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 4-methylidene-5-[(4R)-7-[[1-oxo-2-(2,2,2-trifluoroethyl)-3,4-dihydroisoquinolin-4-yl]oxy]-3,4-dihydro-2H-chromen-4-yl]-1,3-thiazolidin-2-one |
| SMILES | C=C1NC(=O)SC1[C@@H]1CCOc2cc(OC3CN(CC(F)(F)F)C(=O)c4ccccc43)ccc21 |
| InChI | InChI=1S/C24H21F3N2O4S/c1-13-21(34-23(31)28-13)17-8-9-32-19-10-14(6-7-16(17)19)33-20-11-29(12-24(25,26)27)22(30)18-5-3-2-4-15(18)20/h2-7,10,17,20-21H,1,8-9,11-12H2,(H,28,31)/t17-,20?,21?/m1/s1 |
| InChIKey | CXJVXCMSGAXGOB-MDMXATFFSA-N |
| XLogP | 5.03 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.50 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|