C24H33NO6 — CID 58566064
1-O-benzyl 2-O-tert-butyl (2S,5R)-5-[(Z)-5-methoxy-4-methyl-5-oxopent-3-enyl]pyrrolidine-1,2-dicarboxylate (PubChem CID 58566064) has the molecular formula C24H33NO6 and a molecular weight of 431.53 g/mol. Its IUPAC name is 1-O-benzyl 2-O-tert-butyl (2S,5R)-5-[(Z)-5-methoxy-4-methyl-5-oxopent-3-enyl]pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-tert-butyl (2S,5R)-5-[(Z)-5-methoxy-4-methyl-5-oxopent-3-enyl]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 58566064 |
| Molecular Formula | C24H33NO6 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | 1-O-benzyl 2-O-tert-butyl (2S,5R)-5-[(Z)-5-methoxy-4-methyl-5-oxopent-3-enyl]pyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)/C(C)=C\CC[C@@H]1CC[C@@H](C(=O)OC(C)(C)C)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H33NO6/c1-17(21(26)29-5)10-9-13-19-14-15-20(22(27)31-24(2,3)4)25(19)23(28)30-16-18-11-7-6-8-12-18/h6-8,10-12,19-20H,9,13-16H2,1-5H3/b17-10-/t19-,20+/m1/s1 |
| InChIKey | IWHXDFXRSIUWIF-UGHSFDSUSA-N |
| XLogP | 4.40 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|