C16H20N2 — CID 58566180
2,6-di(propan-2-yl)-1,5-dihydropyrrolo[3,2-f]indole (PubChem CID 58566180) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 2,6-di(propan-2-yl)-1,5-dihydropyrrolo[3,2-f]indole.
| Compound Name | 2,6-di(propan-2-yl)-1,5-dihydropyrrolo[3,2-f]indole |
|---|---|
| PubChem CID | 58566180 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 2,6-di(propan-2-yl)-1,5-dihydropyrrolo[3,2-f]indole |
| SMILES | CC(C)C1=Nc2cc3[nH]c(C(C)C)cc3cc2C1 |
| InChI | InChI=1S/C16H20N2/c1-9(2)13-6-11-5-12-7-14(10(3)4)18-16(12)8-15(11)17-13/h5-6,8-10,17H,7H2,1-4H3 |
| InChIKey | REEBZDHSCXHDEQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |