About (7-fluoro-2,2-dimethyl-3H-1-benzofuran-4-yl)methanol
(7-fluoro-2,2-dimethyl-3H-1-benzofuran-4-yl)methanol (PubChem CID 58566323) has the molecular formula C11H13FO2
and a molecular weight of 196.22 g/mol. Its IUPAC name is (7-fluoro-2,2-dimethyl-3H-1-benzofuran-4-yl)methanol.
Molecular Properties
| Compound Name | (7-fluoro-2,2-dimethyl-3H-1-benzofuran-4-yl)methanol |
| PubChem CID | 58566323 |
| Molecular Formula | C11H13FO2 |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | (7-fluoro-2,2-dimethyl-3H-1-benzofuran-4-yl)methanol |
| SMILES | CC1(C)Cc2c(CO)ccc(F)c2O1 |
| InChI | InChI=1S/C11H13FO2/c1-11(2)5-8-7(6-13)3-4-9(12)10(8)14-11/h3-4,13H,5-6H2,1-2H3 |
| InChIKey | WNCHPHOHTQKYIR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (7-fluoro-2,2-dimethyl-3H-1-benzofuran-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-fluoro-2,2-dimethyl-3H-1-benzofuran-4-yl)methanol?
The IUPAC name of (7-fluoro-2,2-dimethyl-3H-1-benzofuran-4-yl)methanol (CID 58566323) is (7-fluoro-2,2-dimethyl-3H-1-benzofuran-4-yl)methanol.
What is the SMILES notation for (7-fluoro-2,2-dimethyl-3H-1-benzofuran-4-yl)methanol?
The canonical SMILES for (7-fluoro-2,2-dimethyl-3H-1-benzofuran-4-yl)methanol is CC1(C)Cc2c(CO)ccc(F)c2O1.
What is the InChIKey of (7-fluoro-2,2-dimethyl-3H-1-benzofuran-4-yl)methanol?
The InChIKey is WNCHPHOHTQKYIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13FO2/c1-11(2)5-8-7(6-13)3-4-9(12)10(8)14-11/h3-4,13H,5-6H2,1-2H3.
What are the key properties of (7-fluoro-2,2-dimethyl-3H-1-benzofuran-4-yl)methanol?
(7-fluoro-2,2-dimethyl-3H-1-benzofuran-4-yl)methanol has a molecular weight of 196.22 g/mol, XLogP of 2.03, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7-fluoro-2,2-dimethyl-3H-1-benzofuran-4-yl)methanol is sourced from PubChem (CID 58566323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).