About (3,4-dichlorophenyl)-pentafluoro-λ6-sulfane
(3,4-dichlorophenyl)-pentafluoro-λ6-sulfane (PubChem CID 58566852) has the molecular formula C6H3Cl2F5S
and a molecular weight of 273.05 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-pentafluoro-λ6-sulfane.
Molecular Properties
| Compound Name | (3,4-dichlorophenyl)-pentafluoro-λ6-sulfane |
| PubChem CID | 58566852 |
| Molecular Formula | C6H3Cl2F5S |
| Molecular Weight | 273.05 g/mol |
| Exact Mass | 271.93 |
| IUPAC Name | (3,4-dichlorophenyl)-pentafluoro-λ6-sulfane |
| SMILES | FS(F)(F)(F)(F)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C6H3Cl2F5S/c7-5-2-1-4(3-6(5)8)14(9,10,11,12)13/h1-3H |
| InChIKey | WPROSWQFGNWTJI-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 273.05 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (3,4-dichlorophenyl)-pentafluoro-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-dichlorophenyl)-pentafluoro-λ6-sulfane?
The IUPAC name of (3,4-dichlorophenyl)-pentafluoro-λ6-sulfane (CID 58566852) is (3,4-dichlorophenyl)-pentafluoro-λ6-sulfane.
What is the SMILES notation for (3,4-dichlorophenyl)-pentafluoro-λ6-sulfane?
The canonical SMILES for (3,4-dichlorophenyl)-pentafluoro-λ6-sulfane is FS(F)(F)(F)(F)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of (3,4-dichlorophenyl)-pentafluoro-λ6-sulfane?
The InChIKey is WPROSWQFGNWTJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Cl2F5S/c7-5-2-1-4(3-6(5)8)14(9,10,11,12)13/h1-3H.
What are the key properties of (3,4-dichlorophenyl)-pentafluoro-λ6-sulfane?
(3,4-dichlorophenyl)-pentafluoro-λ6-sulfane has a molecular weight of 273.05 g/mol, XLogP of 5.65, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dichlorophenyl)-pentafluoro-λ6-sulfane is sourced from PubChem (CID 58566852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).