About 2-methylbutylbenzene;tungsten
2-methylbutylbenzene;tungsten (PubChem CID 58566927) has the molecular formula C11H15W-
and a molecular weight of 331.08 g/mol. Its IUPAC name is 2-methylbutylbenzene;tungsten.
Molecular Properties
| Compound Name | 2-methylbutylbenzene;tungsten |
| PubChem CID | 58566927 |
| Molecular Formula | C11H15W- |
| Molecular Weight | 331.08 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 2-methylbutylbenzene;tungsten |
| SMILES | CC[C-](C)Cc1ccccc1.[W] |
| InChI | InChI=1S/C11H15.W/c1-3-10(2)9-11-7-5-4-6-8-11;/h4-8H,3,9H2,1-2H3;/q-1; |
| InChIKey | BUYMOZWEOHNLMK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.08 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbutylbenzene;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutylbenzene;tungsten?
The IUPAC name of 2-methylbutylbenzene;tungsten (CID 58566927) is 2-methylbutylbenzene;tungsten.
What is the SMILES notation for 2-methylbutylbenzene;tungsten?
The canonical SMILES for 2-methylbutylbenzene;tungsten is CC[C-](C)Cc1ccccc1.[W].
What is the InChIKey of 2-methylbutylbenzene;tungsten?
The InChIKey is BUYMOZWEOHNLMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15.W/c1-3-10(2)9-11-7-5-4-6-8-11;/h4-8H,3,9H2,1-2H3;/q-1;.
What are the key properties of 2-methylbutylbenzene;tungsten?
2-methylbutylbenzene;tungsten has a molecular weight of 331.08 g/mol, XLogP of 3.23, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutylbenzene;tungsten is sourced from PubChem (CID 58566927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).