C21H16N4O4 — CID 58567111
8-[[(2-carboxyquinolin-8-yl)amino]methylamino]quinoline-2-carboxylic acid (PubChem CID 58567111) has the molecular formula C21H16N4O4 and a molecular weight of 388.38 g/mol. Its IUPAC name is 8-[[(2-carboxyquinolin-8-yl)amino]methylamino]quinoline-2-carboxylic acid.
| Compound Name | 8-[[(2-carboxyquinolin-8-yl)amino]methylamino]quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 58567111 |
| Molecular Formula | C21H16N4O4 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 8-[[(2-carboxyquinolin-8-yl)amino]methylamino]quinoline-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2cccc(NCNc3cccc4ccc(C(=O)O)nc34)c2n1 |
| InChI | InChI=1S/C21H16N4O4/c26-20(27)16-9-7-12-3-1-5-14(18(12)24-16)22-11-23-15-6-2-4-13-8-10-17(21(28)29)25-19(13)15/h1-10,22-23H,11H2,(H,26,27)(H,28,29) |
| InChIKey | LNNDIIMRHYZKNQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|