About methyl (3S)-3-(3,5-dimethylphenyl)-2,2-dimethyl-3-trimethylsilyloxypropanoate
methyl (3S)-3-(3,5-dimethylphenyl)-2,2-dimethyl-3-trimethylsilyloxypropanoate (PubChem CID 58567239) has the molecular formula C17H28O3Si
and a molecular weight of 308.49 g/mol. Its IUPAC name is methyl (3S)-3-(3,5-dimethylphenyl)-2,2-dimethyl-3-trimethylsilyloxypropanoate.
Molecular Properties
| Compound Name | methyl (3S)-3-(3,5-dimethylphenyl)-2,2-dimethyl-3-trimethylsilyloxypropanoate |
| PubChem CID | 58567239 |
| Molecular Formula | C17H28O3Si |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | methyl (3S)-3-(3,5-dimethylphenyl)-2,2-dimethyl-3-trimethylsilyloxypropanoate |
| SMILES | COC(=O)C(C)(C)[C@@H](O[Si](C)(C)C)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C17H28O3Si/c1-12-9-13(2)11-14(10-12)15(20-21(6,7)8)17(3,4)16(18)19-5/h9-11,15H,1-8H3/t15-/m0/s1 |
| InChIKey | GJBVMLQMNXMLPC-HNNXBMFYSA-N |
| XLogP | 4.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl (3S)-3-(3,5-dimethylphenyl)-2,2-dimethyl-3-trimethylsilyloxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3S)-3-(3,5-dimethylphenyl)-2,2-dimethyl-3-trimethylsilyloxypropanoate?
The IUPAC name of methyl (3S)-3-(3,5-dimethylphenyl)-2,2-dimethyl-3-trimethylsilyloxypropanoate (CID 58567239) is methyl (3S)-3-(3,5-dimethylphenyl)-2,2-dimethyl-3-trimethylsilyloxypropanoate.
What is the SMILES notation for methyl (3S)-3-(3,5-dimethylphenyl)-2,2-dimethyl-3-trimethylsilyloxypropanoate?
The canonical SMILES for methyl (3S)-3-(3,5-dimethylphenyl)-2,2-dimethyl-3-trimethylsilyloxypropanoate is COC(=O)C(C)(C)[C@@H](O[Si](C)(C)C)c1cc(C)cc(C)c1.
What is the InChIKey of methyl (3S)-3-(3,5-dimethylphenyl)-2,2-dimethyl-3-trimethylsilyloxypropanoate?
The InChIKey is GJBVMLQMNXMLPC-HNNXBMFYSA-N. The full InChI is InChI=1S/C17H28O3Si/c1-12-9-13(2)11-14(10-12)15(20-21(6,7)8)17(3,4)16(18)19-5/h9-11,15H,1-8H3/t15-/m0/s1.
What are the key properties of methyl (3S)-3-(3,5-dimethylphenyl)-2,2-dimethyl-3-trimethylsilyloxypropanoate?
methyl (3S)-3-(3,5-dimethylphenyl)-2,2-dimethyl-3-trimethylsilyloxypropanoate has a molecular weight of 308.49 g/mol, XLogP of 4.40, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S)-3-(3,5-dimethylphenyl)-2,2-dimethyl-3-trimethylsilyloxypropanoate is sourced from PubChem (CID 58567239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).