C18H19F5O3S — CID 58567279
7,7-dimethyl-1-[3-(2,3,4,5,6-pentafluorophenyl)sulfonylpropyl]bicyclo[2.2.1]heptan-2-one (PubChem CID 58567279) has the molecular formula C18H19F5O3S and a molecular weight of 410.40 g/mol. Its IUPAC name is 7,7-dimethyl-1-[3-(2,3,4,5,6-pentafluorophenyl)sulfonylpropyl]bicyclo[2.2.1]heptan-2-one.
| Compound Name | 7,7-dimethyl-1-[3-(2,3,4,5,6-pentafluorophenyl)sulfonylpropyl]bicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 58567279 |
| Molecular Formula | C18H19F5O3S |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 7,7-dimethyl-1-[3-(2,3,4,5,6-pentafluorophenyl)sulfonylpropyl]bicyclo[2.2.1]heptan-2-one |
| SMILES | CC1(C)C2CCC1(CCCS(=O)(=O)c1c(F)c(F)c(F)c(F)c1F)C(=O)C2 |
| InChI | InChI=1S/C18H19F5O3S/c1-17(2)9-4-6-18(17,10(24)8-9)5-3-7-27(25,26)16-14(22)12(20)11(19)13(21)15(16)23/h9H,3-8H2,1-2H3 |
| InChIKey | GHAJEYIVBOYYKF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|