C38H36F2N4O4 — CID 58567446
2-[(3,4-difluorophenyl)methyl]-4-[5-[2-[[4-(5-methoxypentanoyl)phenyl]methyl]quinazolin-6-yl]pent-4-ynoyl]-1,5-dimethylpyrazol-3-one (PubChem CID 58567446) has the molecular formula C38H36F2N4O4 and a molecular weight of 650.73 g/mol. Its IUPAC name is 2-[(3,4-difluorophenyl)methyl]-4-[5-[2-[[4-(5-methoxypentanoyl)phenyl]methyl]quinazolin-6-yl]pent-4-ynoyl]-1,5-dimethylpyrazol-3-one.
| Compound Name | 2-[(3,4-difluorophenyl)methyl]-4-[5-[2-[[4-(5-methoxypentanoyl)phenyl]methyl]quinazolin-6-yl]pent-4-ynoyl]-1,5-dimethylpyrazol-3-one |
|---|---|
| PubChem CID | 58567446 |
| Molecular Formula | C38H36F2N4O4 |
| Molecular Weight | 650.73 g/mol |
| Exact Mass | 650.27 |
| IUPAC Name | 2-[(3,4-difluorophenyl)methyl]-4-[5-[2-[[4-(5-methoxypentanoyl)phenyl]methyl]quinazolin-6-yl]pent-4-ynoyl]-1,5-dimethylpyrazol-3-one |
| SMILES | COCCCCC(=O)c1ccc(Cc2ncc3cc(C#CCCC(=O)c4c(C)n(C)n(Cc5ccc(F)c(F)c5)c4=O)ccc3n2)cc1 |
| InChI | InChI=1S/C38H36F2N4O4/c1-25-37(38(47)44(43(25)2)24-28-13-17-31(39)32(40)21-28)35(46)10-5-4-8-26-14-18-33-30(20-26)23-41-36(42-33)22-27-11-15-29(16-12-27)34(45)9-6-7-19-48-3/h11-18,20-21,23H,5-7,9-10,19,22,24H2,1-3H3 |
| InChIKey | WTGLZUIHHIAALY-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 96.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.73 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|