About 2-methylidene-1,3-di(propan-2-yl)pyrrolidine
2-methylidene-1,3-di(propan-2-yl)pyrrolidine (PubChem CID 58567522) has the molecular formula C11H21N
and a molecular weight of 167.30 g/mol. Its IUPAC name is 2-methylidene-1,3-di(propan-2-yl)pyrrolidine.
Molecular Properties
| Compound Name | 2-methylidene-1,3-di(propan-2-yl)pyrrolidine |
| PubChem CID | 58567522 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | 2-methylidene-1,3-di(propan-2-yl)pyrrolidine |
| SMILES | C=C1C(C(C)C)CCN1C(C)C |
| InChI | InChI=1S/C11H21N/c1-8(2)11-6-7-12(9(3)4)10(11)5/h8-9,11H,5-7H2,1-4H3 |
| InChIKey | CDIISXHQLAIKRD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylidene-1,3-di(propan-2-yl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidene-1,3-di(propan-2-yl)pyrrolidine?
The IUPAC name of 2-methylidene-1,3-di(propan-2-yl)pyrrolidine (CID 58567522) is 2-methylidene-1,3-di(propan-2-yl)pyrrolidine.
What is the SMILES notation for 2-methylidene-1,3-di(propan-2-yl)pyrrolidine?
The canonical SMILES for 2-methylidene-1,3-di(propan-2-yl)pyrrolidine is C=C1C(C(C)C)CCN1C(C)C.
What is the InChIKey of 2-methylidene-1,3-di(propan-2-yl)pyrrolidine?
The InChIKey is CDIISXHQLAIKRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N/c1-8(2)11-6-7-12(9(3)4)10(11)5/h8-9,11H,5-7H2,1-4H3.
What are the key properties of 2-methylidene-1,3-di(propan-2-yl)pyrrolidine?
2-methylidene-1,3-di(propan-2-yl)pyrrolidine has a molecular weight of 167.30 g/mol, XLogP of 2.89, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidene-1,3-di(propan-2-yl)pyrrolidine is sourced from PubChem (CID 58567522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).