About 2-methylidene-1,3-di(propan-2-yl)cyclopentane
2-methylidene-1,3-di(propan-2-yl)cyclopentane (PubChem CID 58567630) has the molecular formula C12H22
and a molecular weight of 166.31 g/mol. Its IUPAC name is 2-methylidene-1,3-di(propan-2-yl)cyclopentane.
Molecular Properties
| Compound Name | 2-methylidene-1,3-di(propan-2-yl)cyclopentane |
| PubChem CID | 58567630 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | 2-methylidene-1,3-di(propan-2-yl)cyclopentane |
| SMILES | C=C1C(C(C)C)CCC1C(C)C |
| InChI | InChI=1S/C12H22/c1-8(2)11-6-7-12(9(3)4)10(11)5/h8-9,11-12H,5-7H2,1-4H3 |
| InChIKey | JEEYHDLUKORVRS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylidene-1,3-di(propan-2-yl)cyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidene-1,3-di(propan-2-yl)cyclopentane?
The IUPAC name of 2-methylidene-1,3-di(propan-2-yl)cyclopentane (CID 58567630) is 2-methylidene-1,3-di(propan-2-yl)cyclopentane.
What is the SMILES notation for 2-methylidene-1,3-di(propan-2-yl)cyclopentane?
The canonical SMILES for 2-methylidene-1,3-di(propan-2-yl)cyclopentane is C=C1C(C(C)C)CCC1C(C)C.
What is the InChIKey of 2-methylidene-1,3-di(propan-2-yl)cyclopentane?
The InChIKey is JEEYHDLUKORVRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22/c1-8(2)11-6-7-12(9(3)4)10(11)5/h8-9,11-12H,5-7H2,1-4H3.
What are the key properties of 2-methylidene-1,3-di(propan-2-yl)cyclopentane?
2-methylidene-1,3-di(propan-2-yl)cyclopentane has a molecular weight of 166.31 g/mol, XLogP of 3.88, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidene-1,3-di(propan-2-yl)cyclopentane is sourced from PubChem (CID 58567630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).