C13H11F3N2O3 — CID 58567667
1,5-dimethyl-3-oxo-2-[(3,4,5-trifluorophenyl)methyl]pyrazole-4-carboxylic acid (PubChem CID 58567667) has the molecular formula C13H11F3N2O3 and a molecular weight of 300.24 g/mol. Its IUPAC name is 1,5-dimethyl-3-oxo-2-[(3,4,5-trifluorophenyl)methyl]pyrazole-4-carboxylic acid.
| Compound Name | 1,5-dimethyl-3-oxo-2-[(3,4,5-trifluorophenyl)methyl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 58567667 |
| Molecular Formula | C13H11F3N2O3 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 1,5-dimethyl-3-oxo-2-[(3,4,5-trifluorophenyl)methyl]pyrazole-4-carboxylic acid |
| SMILES | Cc1c(C(=O)O)c(=O)n(Cc2cc(F)c(F)c(F)c2)n1C |
| InChI | InChI=1S/C13H11F3N2O3/c1-6-10(13(20)21)12(19)18(17(6)2)5-7-3-8(14)11(16)9(15)4-7/h3-4H,5H2,1-2H3,(H,20,21) |
| InChIKey | DOWQIEOZRBJERI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|