C15H15F3N2O3 — CID 58567777
ethyl 1,5-dimethyl-3-oxo-2-[(3,4,5-trifluorophenyl)methyl]pyrazole-4-carboxylate (PubChem CID 58567777) has the molecular formula C15H15F3N2O3 and a molecular weight of 328.29 g/mol. Its IUPAC name is ethyl 1,5-dimethyl-3-oxo-2-[(3,4,5-trifluorophenyl)methyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 1,5-dimethyl-3-oxo-2-[(3,4,5-trifluorophenyl)methyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 58567777 |
| Molecular Formula | C15H15F3N2O3 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | ethyl 1,5-dimethyl-3-oxo-2-[(3,4,5-trifluorophenyl)methyl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(C)n(C)n(Cc2cc(F)c(F)c(F)c2)c1=O |
| InChI | InChI=1S/C15H15F3N2O3/c1-4-23-15(22)12-8(2)19(3)20(14(12)21)7-9-5-10(16)13(18)11(17)6-9/h5-6H,4,7H2,1-3H3 |
| InChIKey | YCDWAQBTQGMORS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|