C25H29F3N2O2S — CID 58567900
N-[(1S,9aR)-1-phenyl-2,3,4,6,7,8,9,9a-octahydroquinolizin-1-yl]-2-methoxy-6-methylsulfanyl-4-(trifluoromethyl)benzamide (PubChem CID 58567900) has the molecular formula C25H29F3N2O2S and a molecular weight of 478.58 g/mol. Its IUPAC name is N-[(1S,9aR)-1-phenyl-2,3,4,6,7,8,9,9a-octahydroquinolizin-1-yl]-2-methoxy-6-methylsulfanyl-4-(trifluoromethyl)benzamide.
| Compound Name | N-[(1S,9aR)-1-phenyl-2,3,4,6,7,8,9,9a-octahydroquinolizin-1-yl]-2-methoxy-6-methylsulfanyl-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 58567900 |
| Molecular Formula | C25H29F3N2O2S |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | N-[(1S,9aR)-1-phenyl-2,3,4,6,7,8,9,9a-octahydroquinolizin-1-yl]-2-methoxy-6-methylsulfanyl-4-(trifluoromethyl)benzamide |
| SMILES | COc1cc(C(F)(F)F)cc(SC)c1C(=O)N[C@]1(c2ccccc2)CCCN2CCCC[C@@H]21 |
| InChI | InChI=1S/C25H29F3N2O2S/c1-32-19-15-18(25(26,27)28)16-20(33-2)22(19)23(31)29-24(17-9-4-3-5-10-17)12-8-14-30-13-7-6-11-21(24)30/h3-5,9-10,15-16,21H,6-8,11-14H2,1-2H3,(H,29,31)/t21-,24+/m1/s1 |
| InChIKey | VEQWRPXCFYIVLR-QPPBQGQZSA-N |
| XLogP | 5.71 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |