C14H18N2O2 — CID 58567903
6-nitro-6-phenyl-2,3,5,7,8,8a-hexahydro-1H-indolizine (PubChem CID 58567903) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 6-nitro-6-phenyl-2,3,5,7,8,8a-hexahydro-1H-indolizine.
| Compound Name | 6-nitro-6-phenyl-2,3,5,7,8,8a-hexahydro-1H-indolizine |
|---|---|
| PubChem CID | 58567903 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 6-nitro-6-phenyl-2,3,5,7,8,8a-hexahydro-1H-indolizine |
| SMILES | O=[N+]([O-])C1(c2ccccc2)CCC2CCCN2C1 |
| InChI | InChI=1S/C14H18N2O2/c17-16(18)14(12-5-2-1-3-6-12)9-8-13-7-4-10-15(13)11-14/h1-3,5-6,13H,4,7-11H2 |
| InChIKey | DDXFLZNPVAJFQN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|