C18H24F4O4 — CID 58568305
3-O-methyl 1-O-(3,3,4,4-tetrafluoropentyl) adamantane-1,3-dicarboxylate (PubChem CID 58568305) has the molecular formula C18H24F4O4 and a molecular weight of 380.38 g/mol. Its IUPAC name is 3-O-methyl 1-O-(3,3,4,4-tetrafluoropentyl) adamantane-1,3-dicarboxylate.
| Compound Name | 3-O-methyl 1-O-(3,3,4,4-tetrafluoropentyl) adamantane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 58568305 |
| Molecular Formula | C18H24F4O4 |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 3-O-methyl 1-O-(3,3,4,4-tetrafluoropentyl) adamantane-1,3-dicarboxylate |
| SMILES | COC(=O)C12CC3CC(C1)CC(C(=O)OCCC(F)(F)C(C)(F)F)(C3)C2 |
| InChI | InChI=1S/C18H24F4O4/c1-15(19,20)18(21,22)3-4-26-14(24)17-8-11-5-12(9-17)7-16(6-11,10-17)13(23)25-2/h11-12H,3-10H2,1-2H3 |
| InChIKey | DFVWCUKMVSTYGV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|