C14H16F4O5 — CID 58568320
4,4,5,5-tetrafluorohexyl 5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-2-carboxylate (PubChem CID 58568320) has the molecular formula C14H16F4O5 and a molecular weight of 340.27 g/mol. Its IUPAC name is 4,4,5,5-tetrafluorohexyl 5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-2-carboxylate.
| Compound Name | 4,4,5,5-tetrafluorohexyl 5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-2-carboxylate |
|---|---|
| PubChem CID | 58568320 |
| Molecular Formula | C14H16F4O5 |
| Molecular Weight | 340.27 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 4,4,5,5-tetrafluorohexyl 5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-2-carboxylate |
| SMILES | CC(F)(F)C(F)(F)CCCOC(=O)C1C2CC3C(=O)OC1C3O2 |
| InChI | InChI=1S/C14H16F4O5/c1-13(15,16)14(17,18)3-2-4-21-12(20)8-7-5-6-9(22-7)10(8)23-11(6)19/h6-10H,2-5H2,1H3 |
| InChIKey | BNHVPZRTVMGSQK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|