C14H22F4O2 — CID 58568348
5,5,6,6-tetrafluoroheptyl cyclohexanecarboxylate (PubChem CID 58568348) has the molecular formula C14H22F4O2 and a molecular weight of 298.32 g/mol. Its IUPAC name is 5,5,6,6-tetrafluoroheptyl cyclohexanecarboxylate.
| Compound Name | 5,5,6,6-tetrafluoroheptyl cyclohexanecarboxylate |
|---|---|
| PubChem CID | 58568348 |
| Molecular Formula | C14H22F4O2 |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 5,5,6,6-tetrafluoroheptyl cyclohexanecarboxylate |
| SMILES | CC(F)(F)C(F)(F)CCCCOC(=O)C1CCCCC1 |
| InChI | InChI=1S/C14H22F4O2/c1-13(15,16)14(17,18)9-5-6-10-20-12(19)11-7-3-2-4-8-11/h11H,2-10H2,1H3 |
| InChIKey | OCTLQLBDWXCYQJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|