C16H20F4O4 — CID 58568352
5,5,6,6-tetrafluoroheptyl 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-2-carboxylate (PubChem CID 58568352) has the molecular formula C16H20F4O4 and a molecular weight of 352.32 g/mol. Its IUPAC name is 5,5,6,6-tetrafluoroheptyl 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-2-carboxylate.
| Compound Name | 5,5,6,6-tetrafluoroheptyl 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-2-carboxylate |
|---|---|
| PubChem CID | 58568352 |
| Molecular Formula | C16H20F4O4 |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 5,5,6,6-tetrafluoroheptyl 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-2-carboxylate |
| SMILES | CC(F)(F)C(F)(F)CCCCOC(=O)C1C2CC3C(=O)OC1C3C2 |
| InChI | InChI=1S/C16H20F4O4/c1-15(17,18)16(19,20)4-2-3-5-23-14(22)11-8-6-9-10(7-8)13(21)24-12(9)11/h8-12H,2-7H2,1H3 |
| InChIKey | UEKGATHVSDTUHH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|