C15H18F4O5 — CID 58568357
5,5,6,6-tetrafluoroheptyl 5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-2-carboxylate (PubChem CID 58568357) has the molecular formula C15H18F4O5 and a molecular weight of 354.30 g/mol. Its IUPAC name is 5,5,6,6-tetrafluoroheptyl 5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-2-carboxylate.
| Compound Name | 5,5,6,6-tetrafluoroheptyl 5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-2-carboxylate |
|---|---|
| PubChem CID | 58568357 |
| Molecular Formula | C15H18F4O5 |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 5,5,6,6-tetrafluoroheptyl 5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-2-carboxylate |
| SMILES | CC(F)(F)C(F)(F)CCCCOC(=O)C1C2CC3C(=O)OC1C3O2 |
| InChI | InChI=1S/C15H18F4O5/c1-14(16,17)15(18,19)4-2-3-5-22-13(21)9-8-6-7-10(23-8)11(9)24-12(7)20/h7-11H,2-6H2,1H3 |
| InChIKey | MLANVBCPFLRFDP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|