About 2-[(4Z)-4-(1-cyanoprop-2-ynylidene)-2,5-diethoxycyclohexa-2,5-dien-1-ylidene]propanedinitrile
2-[(4Z)-4-(1-cyanoprop-2-ynylidene)-2,5-diethoxycyclohexa-2,5-dien-1-ylidene]propanedinitrile (PubChem CID 58569902) has the molecular formula C17H13N3O2
and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-[(4Z)-4-(1-cyanoprop-2-ynylidene)-2,5-diethoxycyclohexa-2,5-dien-1-ylidene]propanedinitrile.
Molecular Properties
| Compound Name | 2-[(4Z)-4-(1-cyanoprop-2-ynylidene)-2,5-diethoxycyclohexa-2,5-dien-1-ylidene]propanedinitrile |
| PubChem CID | 58569902 |
| Molecular Formula | C17H13N3O2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 2-[(4Z)-4-(1-cyanoprop-2-ynylidene)-2,5-diethoxycyclohexa-2,5-dien-1-ylidene]propanedinitrile |
| SMILES | C#C/C(C#N)=c1\cc(OCC)c(=C(C#N)C#N)cc1OCC |
| InChI | InChI=1S/C17H13N3O2/c1-4-12(9-18)14-7-17(22-6-3)15(13(10-19)11-20)8-16(14)21-5-2/h1,7-8H,5-6H2,2-3H3/b14-12- |
| InChIKey | ZDTVZDKLELDOTP-OWBHPGMISA-N |
| XLogP | 0.99 |
| TPSA | 89.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4Z)-4-(1-cyanoprop-2-ynylidene)-2,5-diethoxycyclohexa-2,5-dien-1-ylidene]propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4Z)-4-(1-cyanoprop-2-ynylidene)-2,5-diethoxycyclohexa-2,5-dien-1-ylidene]propanedinitrile?
The IUPAC name of 2-[(4Z)-4-(1-cyanoprop-2-ynylidene)-2,5-diethoxycyclohexa-2,5-dien-1-ylidene]propanedinitrile (CID 58569902) is 2-[(4Z)-4-(1-cyanoprop-2-ynylidene)-2,5-diethoxycyclohexa-2,5-dien-1-ylidene]propanedinitrile.
What is the SMILES notation for 2-[(4Z)-4-(1-cyanoprop-2-ynylidene)-2,5-diethoxycyclohexa-2,5-dien-1-ylidene]propanedinitrile?
The canonical SMILES for 2-[(4Z)-4-(1-cyanoprop-2-ynylidene)-2,5-diethoxycyclohexa-2,5-dien-1-ylidene]propanedinitrile is C#C/C(C#N)=c1\cc(OCC)c(=C(C#N)C#N)cc1OCC.
What is the InChIKey of 2-[(4Z)-4-(1-cyanoprop-2-ynylidene)-2,5-diethoxycyclohexa-2,5-dien-1-ylidene]propanedinitrile?
The InChIKey is ZDTVZDKLELDOTP-OWBHPGMISA-N. The full InChI is InChI=1S/C17H13N3O2/c1-4-12(9-18)14-7-17(22-6-3)15(13(10-19)11-20)8-16(14)21-5-2/h1,7-8H,5-6H2,2-3H3/b14-12-.
What are the key properties of 2-[(4Z)-4-(1-cyanoprop-2-ynylidene)-2,5-diethoxycyclohexa-2,5-dien-1-ylidene]propanedinitrile?
2-[(4Z)-4-(1-cyanoprop-2-ynylidene)-2,5-diethoxycyclohexa-2,5-dien-1-ylidene]propanedinitrile has a molecular weight of 291.31 g/mol, XLogP of 0.99, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4Z)-4-(1-cyanoprop-2-ynylidene)-2,5-diethoxycyclohexa-2,5-dien-1-ylidene]propanedinitrile is sourced from PubChem (CID 58569902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).