About [4-(2-oxobut-3-enoxy)-2,2-bis(prop-2-enoyloxymethyl)butyl] prop-2-enoate
[4-(2-oxobut-3-enoxy)-2,2-bis(prop-2-enoyloxymethyl)butyl] prop-2-enoate (PubChem CID 58570183) has the molecular formula C19H24O8
and a molecular weight of 380.39 g/mol. Its IUPAC name is [4-(2-oxobut-3-enoxy)-2,2-bis(prop-2-enoyloxymethyl)butyl] prop-2-enoate.
Molecular Properties
| Compound Name | [4-(2-oxobut-3-enoxy)-2,2-bis(prop-2-enoyloxymethyl)butyl] prop-2-enoate |
| PubChem CID | 58570183 |
| Molecular Formula | C19H24O8 |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | [4-(2-oxobut-3-enoxy)-2,2-bis(prop-2-enoyloxymethyl)butyl] prop-2-enoate |
| SMILES | C=CC(=O)COCCC(COC(=O)C=C)(COC(=O)C=C)COC(=O)C=C |
| InChI | InChI=1S/C19H24O8/c1-5-15(20)11-24-10-9-19(12-25-16(21)6-2,13-26-17(22)7-3)14-27-18(23)8-4/h5-8H,1-4,9-14H2 |
| InChIKey | OZTVMUVHCAJHGG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [4-(2-oxobut-3-enoxy)-2,2-bis(prop-2-enoyloxymethyl)butyl] prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-oxobut-3-enoxy)-2,2-bis(prop-2-enoyloxymethyl)butyl] prop-2-enoate?
The IUPAC name of [4-(2-oxobut-3-enoxy)-2,2-bis(prop-2-enoyloxymethyl)butyl] prop-2-enoate (CID 58570183) is [4-(2-oxobut-3-enoxy)-2,2-bis(prop-2-enoyloxymethyl)butyl] prop-2-enoate.
What is the SMILES notation for [4-(2-oxobut-3-enoxy)-2,2-bis(prop-2-enoyloxymethyl)butyl] prop-2-enoate?
The canonical SMILES for [4-(2-oxobut-3-enoxy)-2,2-bis(prop-2-enoyloxymethyl)butyl] prop-2-enoate is C=CC(=O)COCCC(COC(=O)C=C)(COC(=O)C=C)COC(=O)C=C.
What is the InChIKey of [4-(2-oxobut-3-enoxy)-2,2-bis(prop-2-enoyloxymethyl)butyl] prop-2-enoate?
The InChIKey is OZTVMUVHCAJHGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24O8/c1-5-15(20)11-24-10-9-19(12-25-16(21)6-2,13-26-17(22)7-3)14-27-18(23)8-4/h5-8H,1-4,9-14H2.
What are the key properties of [4-(2-oxobut-3-enoxy)-2,2-bis(prop-2-enoyloxymethyl)butyl] prop-2-enoate?
[4-(2-oxobut-3-enoxy)-2,2-bis(prop-2-enoyloxymethyl)butyl] prop-2-enoate has a molecular weight of 380.39 g/mol, XLogP of 1.32, 15 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-oxobut-3-enoxy)-2,2-bis(prop-2-enoyloxymethyl)butyl] prop-2-enoate is sourced from PubChem (CID 58570183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).