C21H26ClN5O4 — CID 58570229
(1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-(5,7-diethylfuro[2,3-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 58570229) has the molecular formula C21H26ClN5O4 and a molecular weight of 447.92 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-(5,7-diethylfuro[2,3-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-(5,7-diethylfuro[2,3-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 58570229 |
| Molecular Formula | C21H26ClN5O4 |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | (1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-(5,7-diethylfuro[2,3-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | CCc1cc2cc(-c3c(Cl)nc(N)nc3N[C@@H]3C[C@H](CO)[C@@H](O)[C@H]3O)oc2c(CC)n1 |
| InChI | InChI=1S/C21H26ClN5O4/c1-3-11-5-9-7-14(31-18(9)12(4-2)24-11)15-19(22)26-21(23)27-20(15)25-13-6-10(8-28)16(29)17(13)30/h5,7,10,13,16-17,28-30H,3-4,6,8H2,1-2H3,(H3,23,25,26,27)/t10-,13-,16-,17+/m1/s1 |
| InChIKey | KOGGSUUPTDEMBD-IXZQUYOESA-N |
| XLogP | 2.16 |
| TPSA | 150.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |