C19H20F3N5O2S — CID 58570288
trans-(1R,3R)-3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]cyclopentane-1,2-diol (PubChem CID 58570288) has the molecular formula C19H20F3N5O2S and a molecular weight of 439.46 g/mol. Its IUPAC name is trans-(1R,3R)-3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]cyclopentane-1,2-diol.
| Compound Name | trans-(1R,3R)-3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 58570288 |
| Molecular Formula | C19H20F3N5O2S |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | trans-(1R,3R)-3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]cyclopentane-1,2-diol |
| SMILES | Cc1nc(NCC(F)(F)F)nc(N[C@@H]2CC[C@@H](O)C2O)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H20F3N5O2S/c1-9-14(17-26-10-4-2-3-5-13(10)30-17)16(25-11-6-7-12(28)15(11)29)27-18(24-9)23-8-19(20,21)22/h2-5,11-12,15,28-29H,6-8H2,1H3,(H2,23,24,25,27)/t11-,12-,15?/m1/s1 |
| InChIKey | MZONSFUCRGRMPB-IQQIRFCMSA-N |
| XLogP | 3.33 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |