C10H14ClIN4O3 — CID 58570309
(1R,2S,3R,5R)-3-[(2-amino-6-chloro-5-iodopyrimidin-4-yl)amino]-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 58570309) has the molecular formula C10H14ClIN4O3 and a molecular weight of 400.60 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[(2-amino-6-chloro-5-iodopyrimidin-4-yl)amino]-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[(2-amino-6-chloro-5-iodopyrimidin-4-yl)amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 58570309 |
| Molecular Formula | C10H14ClIN4O3 |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 399.98 |
| IUPAC Name | (1R,2S,3R,5R)-3-[(2-amino-6-chloro-5-iodopyrimidin-4-yl)amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | Nc1nc(Cl)c(I)c(N[C@@H]2C[C@H](CO)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C10H14ClIN4O3/c11-8-5(12)9(16-10(13)15-8)14-4-1-3(2-17)6(18)7(4)19/h3-4,6-7,17-19H,1-2H2,(H3,13,14,15,16)/t3-,4-,6-,7+/m1/s1 |
| InChIKey | DPEMCXPDARPDSD-VLVWYGMNSA-N |
| XLogP | -0.17 |
| TPSA | 124.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|