C12H15ClF3IN4O3 — CID 58570318
(1R,2S,3R,5R)-3-[[6-chloro-5-iodo-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 58570318) has the molecular formula C12H15ClF3IN4O3 and a molecular weight of 482.63 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[[6-chloro-5-iodo-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[[6-chloro-5-iodo-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 58570318 |
| Molecular Formula | C12H15ClF3IN4O3 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 481.98 |
| IUPAC Name | (1R,2S,3R,5R)-3-[[6-chloro-5-iodo-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | OC[C@H]1C[C@@H](Nc2nc(NCC(F)(F)F)nc(Cl)c2I)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H15ClF3IN4O3/c13-9-6(17)10(21-11(20-9)18-3-12(14,15)16)19-5-1-4(2-22)7(23)8(5)24/h4-5,7-8,22-24H,1-3H2,(H2,18,19,20,21)/t4-,5-,7-,8+/m1/s1 |
| InChIKey | YNEYDKKDIXYNNR-APOSLCTFSA-N |
| XLogP | 1.22 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|