C13H18ClIN4O3 — CID 58570356
[(3aS,4R,6R,6aR)-4-[(2-amino-6-chloro-5-iodopyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methanol (PubChem CID 58570356) has the molecular formula C13H18ClIN4O3 and a molecular weight of 440.67 g/mol. Its IUPAC name is [(3aS,4R,6R,6aR)-4-[(2-amino-6-chloro-5-iodopyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methanol.
| Compound Name | [(3aS,4R,6R,6aR)-4-[(2-amino-6-chloro-5-iodopyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methanol |
|---|---|
| PubChem CID | 58570356 |
| Molecular Formula | C13H18ClIN4O3 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 440.01 |
| IUPAC Name | [(3aS,4R,6R,6aR)-4-[(2-amino-6-chloro-5-iodopyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methanol |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO)C[C@@H](Nc3nc(N)nc(Cl)c3I)[C@@H]2O1 |
| InChI | InChI=1S/C13H18ClIN4O3/c1-13(2)21-8-5(4-20)3-6(9(8)22-13)17-11-7(15)10(14)18-12(16)19-11/h5-6,8-9,20H,3-4H2,1-2H3,(H3,16,17,18,19)/t5-,6-,8-,9+/m1/s1 |
| InChIKey | DKIWXYKJSINVDY-GCXDCGAKSA-N |
| XLogP | 1.63 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|