C14H16ClF3N4O3 — CID 58570365
(1R,2S,3R,5R)-3-[[6-chloro-5-ethynyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 58570365) has the molecular formula C14H16ClF3N4O3 and a molecular weight of 380.75 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[[6-chloro-5-ethynyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[[6-chloro-5-ethynyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 58570365 |
| Molecular Formula | C14H16ClF3N4O3 |
| Molecular Weight | 380.75 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | (1R,2S,3R,5R)-3-[[6-chloro-5-ethynyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | C#Cc1c(Cl)nc(NCC(F)(F)F)nc1N[C@@H]1C[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H16ClF3N4O3/c1-2-7-11(15)21-13(19-5-14(16,17)18)22-12(7)20-8-3-6(4-23)9(24)10(8)25/h1,6,8-10,23-25H,3-5H2,(H2,19,20,21,22)/t6-,8-,9-,10+/m1/s1 |
| InChIKey | SETDGWQIOMZJLU-QQRDMOCMSA-N |
| XLogP | 0.60 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.75 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|