C19H22ClN5O4 — CID 58570466
(1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-(7-ethylfuro[2,3-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 58570466) has the molecular formula C19H22ClN5O4 and a molecular weight of 419.87 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-(7-ethylfuro[2,3-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-(7-ethylfuro[2,3-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 58570466 |
| Molecular Formula | C19H22ClN5O4 |
| Molecular Weight | 419.87 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | (1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-(7-ethylfuro[2,3-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | CCc1nccc2cc(-c3c(Cl)nc(N)nc3N[C@@H]3C[C@H](CO)[C@@H](O)[C@H]3O)oc12 |
| InChI | InChI=1S/C19H22ClN5O4/c1-2-10-16-8(3-4-22-10)6-12(29-16)13-17(20)24-19(21)25-18(13)23-11-5-9(7-26)14(27)15(11)28/h3-4,6,9,11,14-15,26-28H,2,5,7H2,1H3,(H3,21,23,24,25)/t9-,11-,14-,15+/m1/s1 |
| InChIKey | XQYIPFIGUALNKC-VGKMCQHDSA-N |
| XLogP | 1.60 |
| TPSA | 150.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.87 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |