C18H24N2O4S — CID 58570499
[(3aS,6aR)-4-[(3-ethynyl-4-methyl-6-methylsulfinyl-2-pyridinyl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methanol (PubChem CID 58570499) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is [(3aS,6aR)-4-[(3-ethynyl-4-methyl-6-methylsulfinyl-2-pyridinyl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methanol.
| Compound Name | [(3aS,6aR)-4-[(3-ethynyl-4-methyl-6-methylsulfinyl-2-pyridinyl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methanol |
|---|---|
| PubChem CID | 58570499 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | [(3aS,6aR)-4-[(3-ethynyl-4-methyl-6-methylsulfinyl-2-pyridinyl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methanol |
| SMILES | C#Cc1c(C)cc(S(C)=O)nc1NC1CC(CO)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C18H24N2O4S/c1-6-12-10(2)7-14(25(5)22)20-17(12)19-13-8-11(9-21)15-16(13)24-18(3,4)23-15/h1,7,11,13,15-16,21H,8-9H2,2-5H3,(H,19,20)/t11?,13?,15-,16+,25?/m1/s1 |
| InChIKey | JYVSUMZUQGXLFN-GAWAKHABSA-N |
| XLogP | 1.42 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|