C23H30N6O2S — CID 58570507
(1S,2R,5R)-5-[[2-[[(1R)-1-cyclopropylethyl]amino]-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-1-methylcyclopentane-1,2-diol (PubChem CID 58570507) has the molecular formula C23H30N6O2S and a molecular weight of 454.60 g/mol. Its IUPAC name is (1S,2R,5R)-5-[[2-[[(1R)-1-cyclopropylethyl]amino]-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-1-methylcyclopentane-1,2-diol.
| Compound Name | (1S,2R,5R)-5-[[2-[[(1R)-1-cyclopropylethyl]amino]-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-1-methylcyclopentane-1,2-diol |
|---|---|
| PubChem CID | 58570507 |
| Molecular Formula | C23H30N6O2S |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | (1S,2R,5R)-5-[[2-[[(1R)-1-cyclopropylethyl]amino]-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-1-methylcyclopentane-1,2-diol |
| SMILES | Cc1nc(N[C@H](C)C2CC2)nc(N[C@@H]2CC[C@@H](O)[C@@]2(C)O)c1-c1nc2c(C)nccc2s1 |
| InChI | InChI=1S/C23H30N6O2S/c1-11(14-5-6-14)25-22-26-12(2)18(21-28-19-13(3)24-10-9-15(19)32-21)20(29-22)27-16-7-8-17(30)23(16,4)31/h9-11,14,16-17,30-31H,5-8H2,1-4H3,(H2,25,26,27,29)/t11-,16-,17-,23+/m1/s1 |
| InChIKey | JHKNGVGJIFSPQJ-LAUCBRTGSA-N |
| XLogP | 3.66 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |