C23H26N6O3S2 — CID 58570556
(1R,2S,3R,5R)-3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-[(4-methyl-1,3-thiazol-2-yl)methylamino]pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 58570556) has the molecular formula C23H26N6O3S2 and a molecular weight of 498.63 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-[(4-methyl-1,3-thiazol-2-yl)methylamino]pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-[(4-methyl-1,3-thiazol-2-yl)methylamino]pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 58570556 |
| Molecular Formula | C23H26N6O3S2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | (1R,2S,3R,5R)-3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-[(4-methyl-1,3-thiazol-2-yl)methylamino]pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | Cc1csc(CNc2nc(C)c(-c3nc4ccccc4s3)c(N[C@@H]3C[C@H](CO)[C@@H](O)[C@H]3O)n2)n1 |
| InChI | InChI=1S/C23H26N6O3S2/c1-11-10-33-17(25-11)8-24-23-26-12(2)18(22-28-14-5-3-4-6-16(14)34-22)21(29-23)27-15-7-13(9-30)19(31)20(15)32/h3-6,10,13,15,19-20,30-32H,7-9H2,1-2H3,(H2,24,26,27,29)/t13-,15-,19-,20+/m1/s1 |
| InChIKey | GJTKNZRMWQPWLH-JNZMBRMSSA-N |
| XLogP | 2.95 |
| TPSA | 136.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |