C22H24N4O3S2 — CID 58570569
(3aS,4R,6aR)-4-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-methylsulfanylpyrimidin-4-yl]amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-6-carbaldehyde (PubChem CID 58570569) has the molecular formula C22H24N4O3S2 and a molecular weight of 456.59 g/mol. Its IUPAC name is (3aS,4R,6aR)-4-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-methylsulfanylpyrimidin-4-yl]amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-6-carbaldehyde.
| Compound Name | (3aS,4R,6aR)-4-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-methylsulfanylpyrimidin-4-yl]amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-6-carbaldehyde |
|---|---|
| PubChem CID | 58570569 |
| Molecular Formula | C22H24N4O3S2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | (3aS,4R,6aR)-4-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-methylsulfanylpyrimidin-4-yl]amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-6-carbaldehyde |
| SMILES | CSc1nc(C)c(-c2nc3ccccc3s2)c(N[C@@H]2CC(C=O)[C@H]3OC(C)(C)O[C@H]32)n1 |
| InChI | InChI=1S/C22H24N4O3S2/c1-11-16(20-25-13-7-5-6-8-15(13)31-20)19(26-21(23-11)30-4)24-14-9-12(10-27)17-18(14)29-22(2,3)28-17/h5-8,10,12,14,17-18H,9H2,1-4H3,(H,23,24,26)/t12?,14-,17-,18+/m1/s1 |
| InChIKey | GHZVZLQXTYPIDH-KIQFRXACSA-N |
| XLogP | 4.30 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|