C24H31N5O5S — CID 58570573
ethyl 4-[[5-(1,3-benzothiazol-2-yl)-4-[[(1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]amino]-6-methylpyrimidin-2-yl]amino]butanoate (PubChem CID 58570573) has the molecular formula C24H31N5O5S and a molecular weight of 501.61 g/mol. Its IUPAC name is ethyl 4-[[5-(1,3-benzothiazol-2-yl)-4-[[(1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]amino]-6-methylpyrimidin-2-yl]amino]butanoate.
| Compound Name | ethyl 4-[[5-(1,3-benzothiazol-2-yl)-4-[[(1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]amino]-6-methylpyrimidin-2-yl]amino]butanoate |
|---|---|
| PubChem CID | 58570573 |
| Molecular Formula | C24H31N5O5S |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | ethyl 4-[[5-(1,3-benzothiazol-2-yl)-4-[[(1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]amino]-6-methylpyrimidin-2-yl]amino]butanoate |
| SMILES | CCOC(=O)CCCNc1nc(C)c(-c2nc3ccccc3s2)c(N[C@@H]2C[C@H](CO)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C24H31N5O5S/c1-3-34-18(31)9-6-10-25-24-26-13(2)19(23-28-15-7-4-5-8-17(15)35-23)22(29-24)27-16-11-14(12-30)20(32)21(16)33/h4-5,7-8,14,16,20-21,30,32-33H,3,6,9-12H2,1-2H3,(H2,25,26,27,29)/t14-,16-,20-,21+/m1/s1 |
| InChIKey | CITXIVNZTGIWIL-XQJRBRMLSA-N |
| XLogP | 2.33 |
| TPSA | 149.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|