C27H32N6O5S — CID 58570638
(1R,2S,3R,5R)-3-[[2-[[(1R)-1-(3,5-dimethoxyphenyl)ethyl]amino]-6-methyl-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 58570638) has the molecular formula C27H32N6O5S and a molecular weight of 552.66 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[[2-[[(1R)-1-(3,5-dimethoxyphenyl)ethyl]amino]-6-methyl-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[[2-[[(1R)-1-(3,5-dimethoxyphenyl)ethyl]amino]-6-methyl-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 58570638 |
| Molecular Formula | C27H32N6O5S |
| Molecular Weight | 552.66 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | (1R,2S,3R,5R)-3-[[2-[[(1R)-1-(3,5-dimethoxyphenyl)ethyl]amino]-6-methyl-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | COc1cc(OC)cc([C@@H](C)Nc2nc(C)c(-c3nc4cnccc4s3)c(N[C@@H]3C[C@H](CO)[C@@H](O)[C@H]3O)n2)c1 |
| InChI | InChI=1S/C27H32N6O5S/c1-13(15-7-17(37-3)10-18(8-15)38-4)29-27-30-14(2)22(26-32-20-11-28-6-5-21(20)39-26)25(33-27)31-19-9-16(12-34)23(35)24(19)36/h5-8,10-11,13,16,19,23-24,34-36H,9,12H2,1-4H3,(H2,29,30,31,33)/t13-,16-,19-,23-,24+/m1/s1 |
| InChIKey | QETOQWLDXZJLOO-GVOFYUMUSA-N |
| XLogP | 3.16 |
| TPSA | 154.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.66 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |