C22H29N5O5 — CID 58570777
(1S,2R,3R,5R)-3-(hydroxymethyl)-5-[[2-(2-methoxyethylamino)-6-methyl-5-(5-methylfuro[2,3-c]pyridin-2-yl)pyrimidin-4-yl]amino]cyclopentane-1,2-diol (PubChem CID 58570777) has the molecular formula C22H29N5O5 and a molecular weight of 443.50 g/mol. Its IUPAC name is (1S,2R,3R,5R)-3-(hydroxymethyl)-5-[[2-(2-methoxyethylamino)-6-methyl-5-(5-methylfuro[2,3-c]pyridin-2-yl)pyrimidin-4-yl]amino]cyclopentane-1,2-diol.
| Compound Name | (1S,2R,3R,5R)-3-(hydroxymethyl)-5-[[2-(2-methoxyethylamino)-6-methyl-5-(5-methylfuro[2,3-c]pyridin-2-yl)pyrimidin-4-yl]amino]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 58570777 |
| Molecular Formula | C22H29N5O5 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | (1S,2R,3R,5R)-3-(hydroxymethyl)-5-[[2-(2-methoxyethylamino)-6-methyl-5-(5-methylfuro[2,3-c]pyridin-2-yl)pyrimidin-4-yl]amino]cyclopentane-1,2-diol |
| SMILES | COCCNc1nc(C)c(-c2cc3cc(C)ncc3o2)c(N[C@@H]2C[C@H](CO)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C22H29N5O5/c1-11-6-13-8-16(32-17(13)9-24-11)18-12(2)25-22(23-4-5-31-3)27-21(18)26-15-7-14(10-28)19(29)20(15)30/h6,8-9,14-15,19-20,28-30H,4-5,7,10H2,1-3H3,(H2,23,25,26,27)/t14-,15-,19-,20+/m1/s1 |
| InChIKey | LWHRKXGUQMCMIR-IONDEXAJSA-N |
| XLogP | 1.47 |
| TPSA | 145.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|