C20H24N6O2S — CID 58570841
(1S,2R,5R)-5-[[2-(cyclopropylamino)-6-methyl-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-1-methylcyclopentane-1,2-diol (PubChem CID 58570841) has the molecular formula C20H24N6O2S and a molecular weight of 412.52 g/mol. Its IUPAC name is (1S,2R,5R)-5-[[2-(cyclopropylamino)-6-methyl-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-1-methylcyclopentane-1,2-diol.
| Compound Name | (1S,2R,5R)-5-[[2-(cyclopropylamino)-6-methyl-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-1-methylcyclopentane-1,2-diol |
|---|---|
| PubChem CID | 58570841 |
| Molecular Formula | C20H24N6O2S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | (1S,2R,5R)-5-[[2-(cyclopropylamino)-6-methyl-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-1-methylcyclopentane-1,2-diol |
| SMILES | Cc1nc(NC2CC2)nc(N[C@@H]2CC[C@@H](O)[C@@]2(C)O)c1-c1nc2cnccc2s1 |
| InChI | InChI=1S/C20H24N6O2S/c1-10-16(18-24-12-9-21-8-7-13(12)29-18)17(26-19(22-10)23-11-3-4-11)25-14-5-6-15(27)20(14,2)28/h7-9,11,14-15,27-28H,3-6H2,1-2H3,(H2,22,23,25,26)/t14-,15-,20+/m1/s1 |
| InChIKey | BWNDZSNDPHMFPH-SXGZJXTBSA-N |
| XLogP | 2.72 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |