C24H33N5O5 — CID 58570859
(1R,2S,3R,5R)-3-[[2-(2-ethoxyethylamino)-5-(5-ethylfuro[2,3-c]pyridin-2-yl)-6-methylpyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 58570859) has the molecular formula C24H33N5O5 and a molecular weight of 471.56 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[[2-(2-ethoxyethylamino)-5-(5-ethylfuro[2,3-c]pyridin-2-yl)-6-methylpyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[[2-(2-ethoxyethylamino)-5-(5-ethylfuro[2,3-c]pyridin-2-yl)-6-methylpyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 58570859 |
| Molecular Formula | C24H33N5O5 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | (1R,2S,3R,5R)-3-[[2-(2-ethoxyethylamino)-5-(5-ethylfuro[2,3-c]pyridin-2-yl)-6-methylpyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | CCOCCNc1nc(C)c(-c2cc3cc(CC)ncc3o2)c(N[C@@H]2C[C@H](CO)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C24H33N5O5/c1-4-16-8-14-10-18(34-19(14)11-26-16)20-13(3)27-24(25-6-7-33-5-2)29-23(20)28-17-9-15(12-30)21(31)22(17)32/h8,10-11,15,17,21-22,30-32H,4-7,9,12H2,1-3H3,(H2,25,27,28,29)/t15-,17-,21-,22+/m1/s1 |
| InChIKey | QSNGQOAMVXHPCW-VIDZHXABSA-N |
| XLogP | 2.12 |
| TPSA | 145.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|