C25H27FN6O3S — CID 58570861
(1R,2S,3R,5R)-3-[[2-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-6-methyl-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 58570861) has the molecular formula C25H27FN6O3S and a molecular weight of 510.60 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[[2-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-6-methyl-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[[2-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-6-methyl-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 58570861 |
| Molecular Formula | C25H27FN6O3S |
| Molecular Weight | 510.60 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | (1R,2S,3R,5R)-3-[[2-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-6-methyl-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | Cc1nc(N[C@H](C)c2ccc(F)cc2)nc(N[C@@H]2C[C@H](CO)[C@@H](O)[C@H]2O)c1-c1nc2cnccc2s1 |
| InChI | InChI=1S/C25H27FN6O3S/c1-12(14-3-5-16(26)6-4-14)28-25-29-13(2)20(24-31-18-10-27-8-7-19(18)36-24)23(32-25)30-17-9-15(11-33)21(34)22(17)35/h3-8,10,12,15,17,21-22,33-35H,9,11H2,1-2H3,(H2,28,29,30,32)/t12-,15-,17-,21-,22+/m1/s1 |
| InChIKey | RJOVZKZQVPAIPA-QUMCAZGJSA-N |
| XLogP | 3.28 |
| TPSA | 136.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.60 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |