C19H20ClN5O5 — CID 58570901
2-[2-amino-4-chloro-6-[[(1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]amino]pyrimidin-5-yl]-1-benzofuran-6-carboxamide (PubChem CID 58570901) has the molecular formula C19H20ClN5O5 and a molecular weight of 433.85 g/mol. Its IUPAC name is 2-[2-amino-4-chloro-6-[[(1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]amino]pyrimidin-5-yl]-1-benzofuran-6-carboxamide.
| Compound Name | 2-[2-amino-4-chloro-6-[[(1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]amino]pyrimidin-5-yl]-1-benzofuran-6-carboxamide |
|---|---|
| PubChem CID | 58570901 |
| Molecular Formula | C19H20ClN5O5 |
| Molecular Weight | 433.85 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 2-[2-amino-4-chloro-6-[[(1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]amino]pyrimidin-5-yl]-1-benzofuran-6-carboxamide |
| SMILES | NC(=O)c1ccc2cc(-c3c(Cl)nc(N)nc3N[C@@H]3C[C@H](CO)[C@@H](O)[C@H]3O)oc2c1 |
| InChI | InChI=1S/C19H20ClN5O5/c20-16-13(12-4-7-1-2-8(17(21)29)5-11(7)30-12)18(25-19(22)24-16)23-10-3-9(6-26)14(27)15(10)28/h1-2,4-5,9-10,14-15,26-28H,3,6H2,(H2,21,29)(H3,22,23,24,25)/t9-,10-,14-,15+/m1/s1 |
| InChIKey | GVQPFOFNQKTFTI-IDMWTJEOSA-N |
| XLogP | 0.74 |
| TPSA | 180.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.85 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |