C22H26ClN5O4S — CID 58570907
(1R,2S,3R,5R)-3-[[5-(1,3-benzothiazol-2-yl)-6-chloro-2-(oxan-4-ylamino)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 58570907) has the molecular formula C22H26ClN5O4S and a molecular weight of 492.00 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[[5-(1,3-benzothiazol-2-yl)-6-chloro-2-(oxan-4-ylamino)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[[5-(1,3-benzothiazol-2-yl)-6-chloro-2-(oxan-4-ylamino)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 58570907 |
| Molecular Formula | C22H26ClN5O4S |
| Molecular Weight | 492.00 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | (1R,2S,3R,5R)-3-[[5-(1,3-benzothiazol-2-yl)-6-chloro-2-(oxan-4-ylamino)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | OC[C@H]1C[C@@H](Nc2nc(NC3CCOCC3)nc(Cl)c2-c2nc3ccccc3s2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H26ClN5O4S/c23-19-16(21-26-13-3-1-2-4-15(13)33-21)20(25-14-9-11(10-29)17(30)18(14)31)28-22(27-19)24-12-5-7-32-8-6-12/h1-4,11-12,14,17-18,29-31H,5-10H2,(H2,24,25,27,28)/t11-,14-,17-,18+/m1/s1 |
| InChIKey | QIRORFAKBGYTCE-DGWLBADLSA-N |
| XLogP | 2.51 |
| TPSA | 132.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.00 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |