C17H19NO5 — CID 58570921
2-[(3aS,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]isoindole-1,3-dione (PubChem CID 58570921) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is 2-[(3aS,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]isoindole-1,3-dione.
| Compound Name | 2-[(3aS,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58570921 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 2-[(3aS,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]isoindole-1,3-dione |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO)C[C@@H](N3C(=O)c4ccccc4C3=O)[C@@H]2O1 |
| InChI | InChI=1S/C17H19NO5/c1-17(2)22-13-9(8-19)7-12(14(13)23-17)18-15(20)10-5-3-4-6-11(10)16(18)21/h3-6,9,12-14,19H,7-8H2,1-2H3/t9-,12-,13-,14+/m1/s1 |
| InChIKey | RPYDZVPDSKNUKO-JXJLXUTGSA-N |
| XLogP | 1.18 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|