C21H22N6O2S2 — CID 58570950
(1R,2S,3R)-3-[[6-methyl-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)-2-(thiophen-2-ylmethylamino)pyrimidin-4-yl]amino]cyclopentane-1,2-diol (PubChem CID 58570950) has the molecular formula C21H22N6O2S2 and a molecular weight of 454.58 g/mol. Its IUPAC name is (1R,2S,3R)-3-[[6-methyl-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)-2-(thiophen-2-ylmethylamino)pyrimidin-4-yl]amino]cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R)-3-[[6-methyl-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)-2-(thiophen-2-ylmethylamino)pyrimidin-4-yl]amino]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 58570950 |
| Molecular Formula | C21H22N6O2S2 |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | (1R,2S,3R)-3-[[6-methyl-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)-2-(thiophen-2-ylmethylamino)pyrimidin-4-yl]amino]cyclopentane-1,2-diol |
| SMILES | Cc1nc(NCc2cccs2)nc(N[C@@H]2CC[C@@H](O)[C@H]2O)c1-c1nc2cnccc2s1 |
| InChI | InChI=1S/C21H22N6O2S2/c1-11-17(20-26-14-10-22-7-6-16(14)31-20)19(25-13-4-5-15(28)18(13)29)27-21(24-11)23-9-12-3-2-8-30-12/h2-3,6-8,10,13,15,18,28-29H,4-5,9H2,1H3,(H2,23,24,25,27)/t13-,15-,18+/m1/s1 |
| InChIKey | DWXGWKCPBIHCII-SIIHOXLZSA-N |
| XLogP | 3.43 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |